C10H19N3OS — CID 115583406
N-cyclopropyl-4-(ethylcarbamothioylamino)butanamide (PubChem CID 115583406) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is N-cyclopropyl-4-(ethylcarbamothioylamino)butanamide.
| Compound Name | N-cyclopropyl-4-(ethylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 115583406 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-cyclopropyl-4-(ethylcarbamothioylamino)butanamide |
| SMILES | CCNC(=S)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C10H19N3OS/c1-2-11-10(15)12-7-3-4-9(14)13-8-5-6-8/h8H,2-7H2,1H3,(H,13,14)(H2,11,12,15) |
| InChIKey | CZZTUDAYYGSATL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|