C8H15N3O2 — CID 78907158
4-(carbamoylamino)-N-cyclopropylbutanamide (PubChem CID 78907158) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-cyclopropylbutanamide.
| Compound Name | 4-(carbamoylamino)-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 78907158 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-(carbamoylamino)-N-cyclopropylbutanamide |
| SMILES | NC(=O)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C8H15N3O2/c9-8(13)10-5-1-2-7(12)11-6-3-4-6/h6H,1-5H2,(H,11,12)(H3,9,10,13) |
| InChIKey | GZFYOPKTLBIEJQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|