C11H20N4O3 — CID 79401001
4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-cyclopropylbutanamide (PubChem CID 79401001) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-cyclopropylbutanamide.
| Compound Name | 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-cyclopropylbutanamide |
|---|---|
| PubChem CID | 79401001 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 4-[[2-[(2-aminoacetyl)amino]acetyl]amino]-N-cyclopropylbutanamide |
| SMILES | NCC(=O)NCC(=O)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C11H20N4O3/c12-6-10(17)14-7-11(18)13-5-1-2-9(16)15-8-3-4-8/h8H,1-7,12H2,(H,13,18)(H,14,17)(H,15,16) |
| InChIKey | ZOYRSWARIDAAON-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|