C18H38N2O5 — CID 167464225
N-cyclobutyl-3-(4-methyl-3-oxopentoxy)propanamide;N-(2-ethoxyethyl)formamide;molecular hydrogen (PubChem CID 167464225) has the molecular formula C18H38N2O5 and a molecular weight of 362.51 g/mol. Its IUPAC name is N-cyclobutyl-3-(4-methyl-3-oxopentoxy)propanamide;N-(2-ethoxyethyl)formamide;molecular hydrogen.
| Compound Name | N-cyclobutyl-3-(4-methyl-3-oxopentoxy)propanamide;N-(2-ethoxyethyl)formamide;molecular hydrogen |
|---|---|
| PubChem CID | 167464225 |
| Molecular Formula | C18H38N2O5 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | N-cyclobutyl-3-(4-methyl-3-oxopentoxy)propanamide;N-(2-ethoxyethyl)formamide;molecular hydrogen |
| SMILES | CC(C)C(=O)CCOCCC(=O)NC1CCC1.CCOCCNC=O.[H][H].[H][H] |
| InChI | InChI=1S/C13H23NO3.C5H11NO2.2H2/c1-10(2)12(15)6-8-17-9-7-13(16)14-11-4-3-5-11;1-2-8-4-3-6-5-7;;/h10-11H,3-9H2,1-2H3,(H,14,16);5H,2-4H2,1H3,(H,6,7);2*1H |
| InChIKey | BAJWWUXRGVAGRL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|