C16H34N2O6 — CID 167464435
molecular hydrogen;N-[2-oxo-2-[2-(2-oxobutoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide (PubChem CID 167464435) has the molecular formula C16H34N2O6 and a molecular weight of 350.46 g/mol. Its IUPAC name is molecular hydrogen;N-[2-oxo-2-[2-(2-oxobutoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide.
| Compound Name | molecular hydrogen;N-[2-oxo-2-[2-(2-oxobutoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide |
|---|---|
| PubChem CID | 167464435 |
| Molecular Formula | C16H34N2O6 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | molecular hydrogen;N-[2-oxo-2-[2-(2-oxobutoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide |
| SMILES | CCC(=O)COCCNC(=O)CNC(=O)CCOCCOC(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C16H30N2O6.2H2/c1-4-14(19)12-23-8-6-17-16(21)11-18-15(20)5-7-22-9-10-24-13(2)3;;/h13H,4-12H2,1-3H3,(H,17,21)(H,18,20);2*1H |
| InChIKey | AMADYUSARATXDR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|