C11H23NO3 — CID 167491249
molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide (PubChem CID 167491249) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide.
| Compound Name | molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide |
|---|---|
| PubChem CID | 167491249 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide |
| SMILES | CCC(=O)CCC(=O)NCCOC(C)C.[H][H] |
| InChI | InChI=1S/C11H21NO3.H2/c1-4-10(13)5-6-11(14)12-7-8-15-9(2)3;/h9H,4-8H2,1-3H3,(H,12,14);1H |
| InChIKey | DNSONGIXRXFWBM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|