molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide

C11H23NO3 — CID 167491249

IUPACmolecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide
SMILESCCC(=O)CCC(=O)NCCOC(C)C.[H][H]
InChIInChI=1S/C11H21NO3.H2/c1-4-10(13)5-6-11(14)12-7-8-15-9(2)3;/h9H,4-8H2,1-3H3,(H,12,14);1H
InChIKeyDNSONGIXRXFWBM-UHFFFAOYSA-N
MW217.31 g/mol
LogP1.53
Rot. Bonds8

About molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide

molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide (PubChem CID 167491249) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide.

Molecular Properties

Compound Namemolecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide
PubChem CID167491249
Molecular FormulaC11H23NO3
Molecular Weight217.31 g/mol
Exact Mass217.17
IUPAC Namemolecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide
SMILESCCC(=O)CCC(=O)NCCOC(C)C.[H][H]
InChIInChI=1S/C11H21NO3.H2/c1-4-10(13)5-6-11(14)12-7-8-15-9(2)3;/h9H,4-8H2,1-3H3,(H,12,14);1H
InChIKeyDNSONGIXRXFWBM-UHFFFAOYSA-N
XLogP1.53
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.31
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide?
The IUPAC name of molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide (CID 167491249) is molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide.
What is the SMILES notation for molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide?
The canonical SMILES for molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide is CCC(=O)CCC(=O)NCCOC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide?
The InChIKey is DNSONGIXRXFWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3.H2/c1-4-10(13)5-6-11(14)12-7-8-15-9(2)3;/h9H,4-8H2,1-3H3,(H,12,14);1H.
What are the key properties of molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide?
molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide has a molecular weight of 217.31 g/mol, XLogP of 1.53, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;4-oxo-N-(2-propan-2-yloxyethyl)hexanamide is sourced from PubChem (CID 167491249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).