C17H36N2O6 — CID 178126322
molecular hydrogen;N-[2-oxo-2-[2-(2-oxopentoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide (PubChem CID 178126322) has the molecular formula C17H36N2O6 and a molecular weight of 364.48 g/mol. Its IUPAC name is molecular hydrogen;N-[2-oxo-2-[2-(2-oxopentoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide.
| Compound Name | molecular hydrogen;N-[2-oxo-2-[2-(2-oxopentoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide |
|---|---|
| PubChem CID | 178126322 |
| Molecular Formula | C17H36N2O6 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | molecular hydrogen;N-[2-oxo-2-[2-(2-oxopentoxy)ethylamino]ethyl]-3-(2-propan-2-yloxyethoxy)propanamide |
| SMILES | CCCC(=O)COCCNC(=O)CNC(=O)CCOCCOC(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C17H32N2O6.2H2/c1-4-5-15(20)13-24-9-7-18-17(22)12-19-16(21)6-8-23-10-11-25-14(2)3;;/h14H,4-13H2,1-3H3,(H,18,22)(H,19,21);2*1H |
| InChIKey | OVFKSKLYSHDACM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|