C20H40N2O4 — CID 178126244
molecular hydrogen;N'-(4-propanoylcyclohexyl)-N-(3-propoxypropyl)pentanediamide (PubChem CID 178126244) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is molecular hydrogen;N'-(4-propanoylcyclohexyl)-N-(3-propoxypropyl)pentanediamide.
| Compound Name | molecular hydrogen;N'-(4-propanoylcyclohexyl)-N-(3-propoxypropyl)pentanediamide |
|---|---|
| PubChem CID | 178126244 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | molecular hydrogen;N'-(4-propanoylcyclohexyl)-N-(3-propoxypropyl)pentanediamide |
| SMILES | CCCOCCCNC(=O)CCCC(=O)NC1CCC(C(=O)CC)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C20H36N2O4.2H2/c1-3-14-26-15-6-13-21-19(24)7-5-8-20(25)22-17-11-9-16(10-12-17)18(23)4-2;;/h16-17H,3-15H2,1-2H3,(H,21,24)(H,22,25);2*1H |
| InChIKey | FDRZZYYNHGAWNK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|