C5H9NO4 — CID 14133519
methyl 2-(methoxycarbonylamino)acetate (PubChem CID 14133519) has the molecular formula C5H9NO4 and a molecular weight of 147.13 g/mol. Its IUPAC name is methyl 2-(methoxycarbonylamino)acetate.
| Compound Name | methyl 2-(methoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 14133519 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | methyl 2-(methoxycarbonylamino)acetate |
| SMILES | COC(=O)CNC(=O)OC |
| InChI | InChI=1S/C5H9NO4/c1-9-4(7)3-6-5(8)10-2/h3H2,1-2H3,(H,6,8) |
| InChIKey | SYMYZVXEVWVLQT-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |