C8H21N3O3 — CID 144526153
methanamine;methyl N-(2-amino-2-oxoethyl)carbamate;propane (PubChem CID 144526153) has the molecular formula C8H21N3O3 and a molecular weight of 207.27 g/mol. Its IUPAC name is methanamine;methyl N-(2-amino-2-oxoethyl)carbamate;propane.
| Compound Name | methanamine;methyl N-(2-amino-2-oxoethyl)carbamate;propane |
|---|---|
| PubChem CID | 144526153 |
| Molecular Formula | C8H21N3O3 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | methanamine;methyl N-(2-amino-2-oxoethyl)carbamate;propane |
| SMILES | CCC.CN.COC(=O)NCC(N)=O |
| InChI | InChI=1S/C4H8N2O3.C3H8.CH5N/c1-9-4(8)6-2-3(5)7;1-3-2;1-2/h2H2,1H3,(H2,5,7)(H,6,8);3H2,1-2H3;2H2,1H3 |
| InChIKey | MZHAMIPJXCLERR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |