C10H19N3O4 — CID 47307690
methyl N-[2-[(2-amino-2-oxoethyl)-butylamino]-2-oxoethyl]carbamate (PubChem CID 47307690) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl N-[2-[(2-amino-2-oxoethyl)-butylamino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[(2-amino-2-oxoethyl)-butylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 47307690 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl N-[2-[(2-amino-2-oxoethyl)-butylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCN(CC(N)=O)C(=O)CNC(=O)OC |
| InChI | InChI=1S/C10H19N3O4/c1-3-4-5-13(7-8(11)14)9(15)6-12-10(16)17-2/h3-7H2,1-2H3,(H2,11,14)(H,12,16) |
| InChIKey | WPNIATXFNHJRNX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |