C9H20ClN3O2 — CID 119294872
3-amino-N-(2-amino-2-oxoethyl)-N-butylpropanamide;hydrochloride (PubChem CID 119294872) has the molecular formula C9H20ClN3O2 and a molecular weight of 237.73 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-oxoethyl)-N-butylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-(2-amino-2-oxoethyl)-N-butylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119294872 |
| Molecular Formula | C9H20ClN3O2 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 3-amino-N-(2-amino-2-oxoethyl)-N-butylpropanamide;hydrochloride |
| SMILES | CCCCN(CC(N)=O)C(=O)CCN.Cl |
| InChI | InChI=1S/C9H19N3O2.ClH/c1-2-3-6-12(7-8(11)13)9(14)4-5-10;/h2-7,10H2,1H3,(H2,11,13);1H |
| InChIKey | NOXWHMGAXHQFBF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |