C5H11ClN2O3 — CID 13029724
methyl 2-[(2-aminoacetyl)amino]acetate;hydrochloride (PubChem CID 13029724) has the molecular formula C5H11ClN2O3 and a molecular weight of 182.61 g/mol. Its IUPAC name is methyl 2-[(2-aminoacetyl)amino]acetate;hydrochloride.
| Compound Name | methyl 2-[(2-aminoacetyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 13029724 |
| Molecular Formula | C5H11ClN2O3 |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | methyl 2-[(2-aminoacetyl)amino]acetate;hydrochloride |
| SMILES | COC(=O)CNC(=O)CN.Cl |
| InChI | InChI=1S/C5H10N2O3.ClH/c1-10-5(9)3-7-4(8)2-6;/h2-3,6H2,1H3,(H,7,8);1H |
| InChIKey | RZOAGVGJBLVHIZ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |