C9H17N3O4 — CID 60851549
methyl 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-methylpropanoate (PubChem CID 60851549) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 60851549 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | methyl 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)CNC(=O)CN |
| InChI | InChI=1S/C9H17N3O4/c1-9(2,8(15)16-3)12-7(14)5-11-6(13)4-10/h4-5,10H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | YYHZPBWNWAKOEJ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |