C10H20N2O3 — CID 60841662
methyl 2-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]propanoate (PubChem CID 60841662) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 2-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]propanoate.
| Compound Name | methyl 2-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 60841662 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | methyl 2-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)CNC(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-7(2)11-6-8(13)12-10(3,4)9(14)15-5/h7,11H,6H2,1-5H3,(H,12,13) |
| InChIKey | LEYJRFJCYFRVED-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |