C4H8FeN2O3 — CID 88519738
2-[(2-aminoacetyl)amino]acetic acid;iron (PubChem CID 88519738) has the molecular formula C4H8FeN2O3 and a molecular weight of 187.96 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]acetic acid;iron.
| Compound Name | 2-[(2-aminoacetyl)amino]acetic acid;iron |
|---|---|
| PubChem CID | 88519738 |
| Molecular Formula | C4H8FeN2O3 |
| Molecular Weight | 187.96 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]acetic acid;iron |
| SMILES | NCC(=O)NCC(=O)O.[Fe] |
| InChI | InChI=1S/C4H8N2O3.Fe/c5-1-3(7)6-2-4(8)9;/h1-2,5H2,(H,6,7)(H,8,9); |
| InChIKey | QFSBKGOVNRRMDH-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.96 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|