About S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate
S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate (PubChem CID 162410967) has the molecular formula C10H12N2O2S
and a molecular weight of 224.29 g/mol. Its IUPAC name is S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate.
Molecular Properties
| Compound Name | S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate |
| PubChem CID | 162410967 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate |
| SMILES | NCC(=O)NCC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C10H12N2O2S/c11-6-9(13)12-7-10(14)15-8-4-2-1-3-5-8/h1-5H,6-7,11H2,(H,12,13) |
| InChIKey | RIJNAKBXVJOZJW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate?
The IUPAC name of S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate (CID 162410967) is S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate.
What is the SMILES notation for S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate?
The canonical SMILES for S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate is NCC(=O)NCC(=O)Sc1ccccc1.
What is the InChIKey of S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate?
The InChIKey is RIJNAKBXVJOZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c11-6-9(13)12-7-10(14)15-8-4-2-1-3-5-8/h1-5H,6-7,11H2,(H,12,13).
What are the key properties of S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate?
S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate has a molecular weight of 224.29 g/mol, XLogP of 0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 2-[(2-aminoacetyl)amino]ethanethioate is sourced from PubChem (CID 162410967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).