About methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate
methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate (PubChem CID 174894322) has the molecular formula C12H17NO3S2
and a molecular weight of 287.41 g/mol. Its IUPAC name is methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate.
Molecular Properties
| Compound Name | methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate |
| PubChem CID | 174894322 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate |
| SMILES | CC(=O)NCC(=O)Sc1ccccc1.CS(C)=O |
| InChI | InChI=1S/C10H11NO2S.C2H6OS/c1-8(12)11-7-10(13)14-9-5-3-2-4-6-9;1-4(2)3/h2-6H,7H2,1H3,(H,11,12);1-2H3 |
| InChIKey | UMNRPVINYSTBTR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate?
The IUPAC name of methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate (CID 174894322) is methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate.
What is the SMILES notation for methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate?
The canonical SMILES for methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate is CC(=O)NCC(=O)Sc1ccccc1.CS(C)=O.
What is the InChIKey of methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate?
The InChIKey is UMNRPVINYSTBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S.C2H6OS/c1-8(12)11-7-10(13)14-9-5-3-2-4-6-9;1-4(2)3/h2-6H,7H2,1H3,(H,11,12);1-2H3.
What are the key properties of methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate?
methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate has a molecular weight of 287.41 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;S-phenyl 2-acetamidoethanethioate is sourced from PubChem (CID 174894322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).