C8H17N3O7S — CID 22493014
bis(2-aminoacetic acid);2-[(2-sulfanylacetyl)amino]acetic acid (PubChem CID 22493014) has the molecular formula C8H17N3O7S and a molecular weight of 299.31 g/mol. Its IUPAC name is bis(2-aminoacetic acid);2-[(2-sulfanylacetyl)amino]acetic acid.
| Compound Name | bis(2-aminoacetic acid);2-[(2-sulfanylacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 22493014 |
| Molecular Formula | C8H17N3O7S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | bis(2-aminoacetic acid);2-[(2-sulfanylacetyl)amino]acetic acid |
| SMILES | NCC(=O)O.NCC(=O)O.O=C(O)CNC(=O)CS |
| InChI | InChI=1S/C4H7NO3S.2C2H5NO2/c6-3(2-9)5-1-4(7)8;2*3-1-2(4)5/h9H,1-2H2,(H,5,6)(H,7,8);2*1,3H2,(H,4,5) |
| InChIKey | WEFFDFHFSFOAMT-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|