C6H12N2O4S — CID 174585763
2-aminoacetic acid;2-(ethanethioylamino)acetic acid (PubChem CID 174585763) has the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-aminoacetic acid;2-(ethanethioylamino)acetic acid.
| Compound Name | 2-aminoacetic acid;2-(ethanethioylamino)acetic acid |
|---|---|
| PubChem CID | 174585763 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-aminoacetic acid;2-(ethanethioylamino)acetic acid |
| SMILES | CC(=S)NCC(=O)O.NCC(=O)O |
| InChI | InChI=1S/C4H7NO2S.C2H5NO2/c1-3(8)5-2-4(6)7;3-1-2(4)5/h2H2,1H3,(H,5,8)(H,6,7);1,3H2,(H,4,5) |
| InChIKey | ZWWWJMLEWDWKTC-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|