C6H9F3N2O5 — CID 160881248
2-aminoacetic acid;2-[(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 160881248) has the molecular formula C6H9F3N2O5 and a molecular weight of 246.14 g/mol. Its IUPAC name is 2-aminoacetic acid;2-[(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-aminoacetic acid;2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 160881248 |
| Molecular Formula | C6H9F3N2O5 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-aminoacetic acid;2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | NCC(=O)O.O=C(O)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C4H4F3NO3.C2H5NO2/c5-4(6,7)3(11)8-1-2(9)10;3-1-2(4)5/h1H2,(H,8,11)(H,9,10);1,3H2,(H,4,5) |
| InChIKey | SNBCMPWMEKQMPA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |