C10H21ClN2O3 — CID 119344212
methyl 3-[(2-aminoacetyl)amino]-3-ethylpentanoate;hydrochloride (PubChem CID 119344212) has the molecular formula C10H21ClN2O3 and a molecular weight of 252.74 g/mol. Its IUPAC name is methyl 3-[(2-aminoacetyl)amino]-3-ethylpentanoate;hydrochloride.
| Compound Name | methyl 3-[(2-aminoacetyl)amino]-3-ethylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 119344212 |
| Molecular Formula | C10H21ClN2O3 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl 3-[(2-aminoacetyl)amino]-3-ethylpentanoate;hydrochloride |
| SMILES | CCC(CC)(CC(=O)OC)NC(=O)CN.Cl |
| InChI | InChI=1S/C10H20N2O3.ClH/c1-4-10(5-2,6-9(14)15-3)12-8(13)7-11;/h4-7,11H2,1-3H3,(H,12,13);1H |
| InChIKey | IHASGUHBAMLPHW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |