C11H23ClN2O3 — CID 119344210
methyl 3-(3-aminopropanoylamino)-3-ethylpentanoate;hydrochloride (PubChem CID 119344210) has the molecular formula C11H23ClN2O3 and a molecular weight of 266.77 g/mol. Its IUPAC name is methyl 3-(3-aminopropanoylamino)-3-ethylpentanoate;hydrochloride.
| Compound Name | methyl 3-(3-aminopropanoylamino)-3-ethylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 119344210 |
| Molecular Formula | C11H23ClN2O3 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | methyl 3-(3-aminopropanoylamino)-3-ethylpentanoate;hydrochloride |
| SMILES | CCC(CC)(CC(=O)OC)NC(=O)CCN.Cl |
| InChI | InChI=1S/C11H22N2O3.ClH/c1-4-11(5-2,8-10(15)16-3)13-9(14)6-7-12;/h4-8,12H2,1-3H3,(H,13,14);1H |
| InChIKey | MYBXAUVSMWFULC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |