C17H30N2O3 — CID 119819819
methyl 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-ethylpentanoate (PubChem CID 119819819) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is methyl 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-ethylpentanoate.
| Compound Name | methyl 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-ethylpentanoate |
|---|---|
| PubChem CID | 119819819 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | methyl 3-[[2-(8-azabicyclo[3.2.1]octan-3-yl)acetyl]amino]-3-ethylpentanoate |
| SMILES | CCC(CC)(CC(=O)OC)NC(=O)CC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C17H30N2O3/c1-4-17(5-2,11-16(21)22-3)19-15(20)10-12-8-13-6-7-14(9-12)18-13/h12-14,18H,4-11H2,1-3H3,(H,19,20) |
| InChIKey | VTQLHHKKYIUREB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |