C11H21NO5 — CID 104630271
ethyl 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-oxobutanoate (PubChem CID 104630271) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 104630271 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | ethyl 4-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC(CC)(CO)CO |
| InChI | InChI=1S/C11H21NO5/c1-3-11(7-13,8-14)12-9(15)5-6-10(16)17-4-2/h13-14H,3-8H2,1-2H3,(H,12,15) |
| InChIKey | FFYOIKPUCQNDAX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |