C8H17NO3 — CID 19031150
N-(2,6-dihydroxyhexyl)acetamide (PubChem CID 19031150) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(2,6-dihydroxyhexyl)acetamide.
| Compound Name | N-(2,6-dihydroxyhexyl)acetamide |
|---|---|
| PubChem CID | 19031150 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | N-(2,6-dihydroxyhexyl)acetamide |
| SMILES | CC(=O)NCC(O)CCCCO |
| InChI | InChI=1S/C8H17NO3/c1-7(11)9-6-8(12)4-2-3-5-10/h8,10,12H,2-6H2,1H3,(H,9,11) |
| InChIKey | CVOYZAGOPUMXIN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|