C7H14F2N2O2 — CID 103810605
N-(3,3-difluoro-2-hydroxypropyl)-2-(ethylamino)acetamide (PubChem CID 103810605) has the molecular formula C7H14F2N2O2 and a molecular weight of 196.20 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2-(ethylamino)acetamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(ethylamino)acetamide |
|---|---|
| PubChem CID | 103810605 |
| Molecular Formula | C7H14F2N2O2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(ethylamino)acetamide |
| SMILES | CCNCC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C7H14F2N2O2/c1-2-10-4-6(13)11-3-5(12)7(8)9/h5,7,10,12H,2-4H2,1H3,(H,11,13) |
| InChIKey | DUDZHHBIMZMOLW-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |