C5H10F2N2O2 — CID 103734263
1-(3,3-difluoro-2-hydroxypropyl)-3-methylurea (PubChem CID 103734263) has the molecular formula C5H10F2N2O2 and a molecular weight of 168.14 g/mol. Its IUPAC name is 1-(3,3-difluoro-2-hydroxypropyl)-3-methylurea.
| Compound Name | 1-(3,3-difluoro-2-hydroxypropyl)-3-methylurea |
|---|---|
| PubChem CID | 103734263 |
| Molecular Formula | C5H10F2N2O2 |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1-(3,3-difluoro-2-hydroxypropyl)-3-methylurea |
| SMILES | CNC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C5H10F2N2O2/c1-8-5(11)9-2-3(10)4(6)7/h3-4,10H,2H2,1H3,(H2,8,9,11) |
| InChIKey | FCMGXKGREGAHGV-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |