C6H10ClF2NO2 — CID 103881719
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)propanamide (PubChem CID 103881719) has the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)propanamide.
| Compound Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 103881719 |
| Molecular Formula | C6H10ClF2NO2 |
| Molecular Weight | 201.60 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)propanamide |
| SMILES | CC(Cl)C(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C6H10ClF2NO2/c1-3(7)6(12)10-2-4(11)5(8)9/h3-5,11H,2H2,1H3,(H,10,12) |
| InChIKey | KKEUMWZZYYWIMJ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.60 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|