C6H10ClNO — CID 14203945
(2S)-2-chloro-N-prop-2-enylpropanamide (PubChem CID 14203945) has the molecular formula C6H10ClNO and a molecular weight of 147.60 g/mol. Its IUPAC name is (2S)-2-chloro-N-prop-2-enylpropanamide.
| Compound Name | (2S)-2-chloro-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 14203945 |
| Molecular Formula | C6H10ClNO |
| Molecular Weight | 147.60 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (2S)-2-chloro-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@H](C)Cl |
| InChI | InChI=1S/C6H10ClNO/c1-3-4-8-6(9)5(2)7/h3,5H,1,4H2,2H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | IGQVZORBBWSCKH-YFKPBYRVSA-N |
| XLogP | 0.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.60 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|