C17H33NO3 — CID 90762380
(2S)-2,4-dimethylpentanoic acid;(2S)-2,4-dimethyl-N-prop-2-enylpentanamide (PubChem CID 90762380) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (2S)-2,4-dimethylpentanoic acid;(2S)-2,4-dimethyl-N-prop-2-enylpentanamide.
| Compound Name | (2S)-2,4-dimethylpentanoic acid;(2S)-2,4-dimethyl-N-prop-2-enylpentanamide |
|---|---|
| PubChem CID | 90762380 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | (2S)-2,4-dimethylpentanoic acid;(2S)-2,4-dimethyl-N-prop-2-enylpentanamide |
| SMILES | C=CCNC(=O)[C@@H](C)CC(C)C.CC(C)C[C@H](C)C(=O)O |
| InChI | InChI=1S/C10H19NO.C7H14O2/c1-5-6-11-10(12)9(4)7-8(2)3;1-5(2)4-6(3)7(8)9/h5,8-9H,1,6-7H2,2-4H3,(H,11,12);5-6H,4H2,1-3H3,(H,8,9)/t9-;6-/m00/s1 |
| InChIKey | UQVHESLBFBZSPO-NRDCADONSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|