C6H12F2N2O2 — CID 103734264
1-(3,3-difluoro-2-hydroxypropyl)-3-ethylurea (PubChem CID 103734264) has the molecular formula C6H12F2N2O2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-(3,3-difluoro-2-hydroxypropyl)-3-ethylurea.
| Compound Name | 1-(3,3-difluoro-2-hydroxypropyl)-3-ethylurea |
|---|---|
| PubChem CID | 103734264 |
| Molecular Formula | C6H12F2N2O2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-(3,3-difluoro-2-hydroxypropyl)-3-ethylurea |
| SMILES | CCNC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C6H12F2N2O2/c1-2-9-6(12)10-3-4(11)5(7)8/h4-5,11H,2-3H2,1H3,(H2,9,10,12) |
| InChIKey | BDFSMHFYNLTYLM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |