C7H17N3O2 — CID 64541484
1-(2-amino-3-hydroxybutyl)-3-ethylurea (PubChem CID 64541484) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(2-amino-3-hydroxybutyl)-3-ethylurea.
| Compound Name | 1-(2-amino-3-hydroxybutyl)-3-ethylurea |
|---|---|
| PubChem CID | 64541484 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 1-(2-amino-3-hydroxybutyl)-3-ethylurea |
| SMILES | CCNC(=O)NCC(N)C(C)O |
| InChI | InChI=1S/C7H17N3O2/c1-3-9-7(12)10-4-6(8)5(2)11/h5-6,11H,3-4,8H2,1-2H3,(H2,9,10,12) |
| InChIKey | QGOSQQDRNNYAEG-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |