C6H16Cl2N4OPt — CID 10093944
1-(2,3-diaminopropyl)-3-ethylurea;platinum(2+);dichloride (PubChem CID 10093944) has the molecular formula C6H16Cl2N4OPt and a molecular weight of 426.21 g/mol. Its IUPAC name is 1-(2,3-diaminopropyl)-3-ethylurea;platinum(2+);dichloride.
| Compound Name | 1-(2,3-diaminopropyl)-3-ethylurea;platinum(2+);dichloride |
|---|---|
| PubChem CID | 10093944 |
| Molecular Formula | C6H16Cl2N4OPt |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 1-(2,3-diaminopropyl)-3-ethylurea;platinum(2+);dichloride |
| SMILES | CCNC(=O)NCC(N)CN.[Cl-].[Cl-].[Pt+2] |
| InChI | InChI=1S/C6H16N4O.2ClH.Pt/c1-2-9-6(11)10-4-5(8)3-7;;;/h5H,2-4,7-8H2,1H3,(H2,9,10,11);2*1H;/q;;;+2/p-2 |
| InChIKey | VDKHYPGDQUOQGZ-UHFFFAOYSA-L |
| XLogP | -7.40 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | -7.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |