C6H15N3O2 — CID 131223085
1-(3-amino-2-hydroxypropyl)-3-ethylurea (PubChem CID 131223085) has the molecular formula C6H15N3O2 and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-(3-amino-2-hydroxypropyl)-3-ethylurea.
| Compound Name | 1-(3-amino-2-hydroxypropyl)-3-ethylurea |
|---|---|
| PubChem CID | 131223085 |
| Molecular Formula | C6H15N3O2 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-(3-amino-2-hydroxypropyl)-3-ethylurea |
| SMILES | CCNC(=O)NCC(O)CN |
| InChI | InChI=1S/C6H15N3O2/c1-2-8-6(11)9-4-5(10)3-7/h5,10H,2-4,7H2,1H3,(H2,8,9,11) |
| InChIKey | TVUIJJDGXJOJKU-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |