C7H10F6N2O — CID 22005457
1,3-bis(2,3,3-trifluoropropyl)urea (PubChem CID 22005457) has the molecular formula C7H10F6N2O and a molecular weight of 252.16 g/mol. Its IUPAC name is 1,3-bis(2,3,3-trifluoropropyl)urea.
| Compound Name | 1,3-bis(2,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 22005457 |
| Molecular Formula | C7H10F6N2O |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1,3-bis(2,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCC(F)C(F)F)NCC(F)C(F)F |
| InChI | InChI=1S/C7H10F6N2O/c8-3(5(10)11)1-14-7(16)15-2-4(9)6(12)13/h3-6H,1-2H2,(H2,14,15,16) |
| InChIKey | DQZLBMDTBXCUDZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |