C7H16N2O5 — CID 57276447
1,3-bis(2-hydroxy-2-methoxyethyl)urea (PubChem CID 57276447) has the molecular formula C7H16N2O5 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1,3-bis(2-hydroxy-2-methoxyethyl)urea.
| Compound Name | 1,3-bis(2-hydroxy-2-methoxyethyl)urea |
|---|---|
| PubChem CID | 57276447 |
| Molecular Formula | C7H16N2O5 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1,3-bis(2-hydroxy-2-methoxyethyl)urea |
| SMILES | COC(O)CNC(=O)NCC(O)OC |
| InChI | InChI=1S/C7H16N2O5/c1-13-5(10)3-8-7(12)9-4-6(11)14-2/h5-6,10-11H,3-4H2,1-2H3,(H2,8,9,12) |
| InChIKey | DGZGBJYNJLWLEC-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|