C8H14F2N2O2 — CID 103810588
2-(azetidin-3-yl)-N-(3,3-difluoro-2-hydroxypropyl)acetamide (PubChem CID 103810588) has the molecular formula C8H14F2N2O2 and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(3,3-difluoro-2-hydroxypropyl)acetamide.
| Compound Name | 2-(azetidin-3-yl)-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 103810588 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(CC1CNC1)NCC(O)C(F)F |
| InChI | InChI=1S/C8H14F2N2O2/c9-8(10)6(13)4-12-7(14)1-5-2-11-3-5/h5-6,8,11,13H,1-4H2,(H,12,14) |
| InChIKey | DABWOXPXRVIKGH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |