C10H18F2N2O2 — CID 103859922
N-(3,3-difluoro-2-hydroxypropyl)-3-pyrrolidin-3-ylpropanamide (PubChem CID 103859922) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-pyrrolidin-3-ylpropanamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-pyrrolidin-3-ylpropanamide |
|---|---|
| PubChem CID | 103859922 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-pyrrolidin-3-ylpropanamide |
| SMILES | O=C(CCC1CCNC1)NCC(O)C(F)F |
| InChI | InChI=1S/C10H18F2N2O2/c11-10(12)8(15)6-14-9(16)2-1-7-3-4-13-5-7/h7-8,10,13,15H,1-6H2,(H,14,16) |
| InChIKey | YAUCAOQADDMINT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |