C8H16N2O3 — CID 66169543
2-(azetidin-3-yl)-N-(2,3-dihydroxypropyl)acetamide (PubChem CID 66169543) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-(2,3-dihydroxypropyl)acetamide.
| Compound Name | 2-(azetidin-3-yl)-N-(2,3-dihydroxypropyl)acetamide |
|---|---|
| PubChem CID | 66169543 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-(azetidin-3-yl)-N-(2,3-dihydroxypropyl)acetamide |
| SMILES | O=C(CC1CNC1)NCC(O)CO |
| InChI | InChI=1S/C8H16N2O3/c11-5-7(12)4-10-8(13)1-6-2-9-3-6/h6-7,9,11-12H,1-5H2,(H,10,13) |
| InChIKey | BPDZUCHIJQSRSG-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |