C10H20N2O3S — CID 114627744
N-(2,3-dihydroxypropyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114627744) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114627744 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)NCC(O)CO |
| InChI | InChI=1S/C10H20N2O3S/c13-6-8(14)5-12-10(15)7-16-9-1-3-11-4-2-9/h8-9,11,13-14H,1-7H2,(H,12,15) |
| InChIKey | APRRWNCXXIPOHV-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |