C16H31N3OS — CID 114627251
N-(3-methyl-2-pyrrolidin-1-ylbutyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114627251) has the molecular formula C16H31N3OS and a molecular weight of 313.51 g/mol. Its IUPAC name is N-(3-methyl-2-pyrrolidin-1-ylbutyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(3-methyl-2-pyrrolidin-1-ylbutyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114627251 |
| Molecular Formula | C16H31N3OS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-(3-methyl-2-pyrrolidin-1-ylbutyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | CC(C)C(CNC(=O)CSC1CCNCC1)N1CCCC1 |
| InChI | InChI=1S/C16H31N3OS/c1-13(2)15(19-9-3-4-10-19)11-18-16(20)12-21-14-5-7-17-8-6-14/h13-15,17H,3-12H2,1-2H3,(H,18,20) |
| InChIKey | PJRSXYTYYLINCZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |