C10H20N2O3S2 — CID 103307451
2-piperidin-4-ylsulfanyl-N-propylsulfonylacetamide (PubChem CID 103307451) has the molecular formula C10H20N2O3S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-piperidin-4-ylsulfanyl-N-propylsulfonylacetamide.
| Compound Name | 2-piperidin-4-ylsulfanyl-N-propylsulfonylacetamide |
|---|---|
| PubChem CID | 103307451 |
| Molecular Formula | C10H20N2O3S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-piperidin-4-ylsulfanyl-N-propylsulfonylacetamide |
| SMILES | CCCS(=O)(=O)NC(=O)CSC1CCNCC1 |
| InChI | InChI=1S/C10H20N2O3S2/c1-2-7-17(14,15)12-10(13)8-16-9-3-5-11-6-4-9/h9,11H,2-8H2,1H3,(H,12,13) |
| InChIKey | BZIVEKGGQHWSEV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |