C11H23N3O3S2 — CID 106336452
N-[3-(methanesulfonamido)propyl]-2-piperidin-4-ylsulfanylacetamide (PubChem CID 106336452) has the molecular formula C11H23N3O3S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)propyl]-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-[3-(methanesulfonamido)propyl]-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 106336452 |
| Molecular Formula | C11H23N3O3S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | N-[3-(methanesulfonamido)propyl]-2-piperidin-4-ylsulfanylacetamide |
| SMILES | CS(=O)(=O)NCCCNC(=O)CSC1CCNCC1 |
| InChI | InChI=1S/C11H23N3O3S2/c1-19(16,17)14-6-2-5-13-11(15)9-18-10-3-7-12-8-4-10/h10,12,14H,2-9H2,1H3,(H,13,15) |
| InChIKey | FLFOFOFGPMJWQS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|