C12H23N3O2S — CID 106235677
5-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanamide (PubChem CID 106235677) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanamide.
| Compound Name | 5-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 106235677 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanamide |
| SMILES | NC(=O)CCCCNC(=O)CSC1CCNCC1 |
| InChI | InChI=1S/C12H23N3O2S/c13-11(16)3-1-2-6-15-12(17)9-18-10-4-7-14-8-5-10/h10,14H,1-9H2,(H2,13,16)(H,15,17) |
| InChIKey | ZALNLIHWAFGFCP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|