C13H26N2O2S — CID 107842483
N-(6-hydroxyhexyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 107842483) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(6-hydroxyhexyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 107842483 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(6-hydroxyhexyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)NCCCCCCO |
| InChI | InChI=1S/C13H26N2O2S/c16-10-4-2-1-3-7-15-13(17)11-18-12-5-8-14-9-6-12/h12,14,16H,1-11H2,(H,15,17) |
| InChIKey | YLRXPQPJBGKONS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|