C7H10F4N2O2 — CID 103732179
N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732179) has the molecular formula C7H10F4N2O2 and a molecular weight of 230.16 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732179 |
| Molecular Formula | C7H10F4N2O2 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | CN(C)C(=O)CNC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H10F4N2O2/c1-13(2)4(14)3-12-6(15)7(10,11)5(8)9/h5H,3H2,1-2H3,(H,12,15) |
| InChIKey | NBKBPVZYIGMVBD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|