C8H11F7N2O — CID 163196984
N-[2-(dimethylamino)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 163196984) has the molecular formula C8H11F7N2O and a molecular weight of 284.18 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 163196984 |
| Molecular Formula | C8H11F7N2O |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CN(C)CCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F7N2O/c1-17(2)4-3-16-5(18)6(9,10)7(11,12)8(13,14)15/h3-4H2,1-2H3,(H,16,18) |
| InChIKey | OPDNXIQZYCYEQT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|