C11H5F15N2O3 — CID 91726862
N-[2-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]ethyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 91726862) has the molecular formula C11H5F15N2O3 and a molecular weight of 498.14 g/mol. Its IUPAC name is N-[2-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]ethyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[2-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]ethyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 91726862 |
| Molecular Formula | C11H5F15N2O3 |
| Molecular Weight | 498.14 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | N-[2-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]ethyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(NCCN(C(=O)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F15N2O3/c12-6(13,9(18,19)20)3(29)27-1-2-28(4(30)7(14,15)10(21,22)23)5(31)8(16,17)11(24,25)26/h1-2H2,(H,27,29) |
| InChIKey | CBTPAJWDIKMAGA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.14 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|