C10H12F6N2O3 — CID 91691838
N-[4-[acetyl-(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide (PubChem CID 91691838) has the molecular formula C10H12F6N2O3 and a molecular weight of 322.21 g/mol. Its IUPAC name is N-[4-[acetyl-(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[acetyl-(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 91691838 |
| Molecular Formula | C10H12F6N2O3 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[4-[acetyl-(2,2,2-trifluoroacetyl)amino]butyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(=O)N(CCCCNC(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F6N2O3/c1-6(19)18(8(21)10(14,15)16)5-3-2-4-17-7(20)9(11,12)13/h2-5H2,1H3,(H,17,20) |
| InChIKey | VENILQKZFRWLKU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|